C15H22Cl2O2 — CID 91259452
5-(1,1-dichloroprop-1-en-2-yl)-3,8-dimethyl-4,4a,5,6,7,8-hexahydro-1H-naphthalene-1,8a-diol (PubChem CID 91259452) has the molecular formula C15H22Cl2O2 and a molecular weight of 305.25 g/mol. Its IUPAC name is 5-(1,1-dichloroprop-1-en-2-yl)-3,8-dimethyl-4,4a,5,6,7,8-hexahydro-1H-naphthalene-1,8a-diol.
| Compound Name | 5-(1,1-dichloroprop-1-en-2-yl)-3,8-dimethyl-4,4a,5,6,7,8-hexahydro-1H-naphthalene-1,8a-diol |
|---|---|
| PubChem CID | 91259452 |
| Molecular Formula | C15H22Cl2O2 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5-(1,1-dichloroprop-1-en-2-yl)-3,8-dimethyl-4,4a,5,6,7,8-hexahydro-1H-naphthalene-1,8a-diol |
| SMILES | CC1=CC(O)C2(O)C(C)CCC(C(C)=C(Cl)Cl)C2C1 |
| InChI | InChI=1S/C15H22Cl2O2/c1-8-6-12-11(10(3)14(16)17)5-4-9(2)15(12,19)13(18)7-8/h7,9,11-13,18-19H,4-6H2,1-3H3 |
| InChIKey | NRNPQENFBOQSJD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|