C33H38 — CID 91259786
2-[2-(3-butyl-3-methyl-5-prop-1-ynylcyclohepta-1,4,6-trien-1-yl)ethynyl]-7-methyl-7-pent-4-enyl-5-prop-1-ynylcyclohepta-1,3,5-triene (PubChem CID 91259786) has the molecular formula C33H38 and a molecular weight of 434.67 g/mol. Its IUPAC name is 2-[2-(3-butyl-3-methyl-5-prop-1-ynylcyclohepta-1,4,6-trien-1-yl)ethynyl]-7-methyl-7-pent-4-enyl-5-prop-1-ynylcyclohepta-1,3,5-triene.
| Compound Name | 2-[2-(3-butyl-3-methyl-5-prop-1-ynylcyclohepta-1,4,6-trien-1-yl)ethynyl]-7-methyl-7-pent-4-enyl-5-prop-1-ynylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 91259786 |
| Molecular Formula | C33H38 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2-[2-(3-butyl-3-methyl-5-prop-1-ynylcyclohepta-1,4,6-trien-1-yl)ethynyl]-7-methyl-7-pent-4-enyl-5-prop-1-ynylcyclohepta-1,3,5-triene |
| SMILES | C=CCCCC1(C)C=C(C#CC)C=CC(C#CC2=CC(C)(CCCC)C=C(C#CC)C=C2)=C1 |
| InChI | InChI=1S/C33H38/c1-7-11-13-23-33(6)25-29(15-10-4)17-19-31(27-33)21-20-30-18-16-28(14-9-3)24-32(5,26-30)22-12-8-2/h7,16-19,24-27H,1,8,11-13,22-23H2,2-6H3 |
| InChIKey | NOGCDFMNPUKJSL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|