C28H36N2O6S — CID 91259802
(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-9-phenyl-2,3-dihydro-1,5-benzothiazepin-3-yl)non-6-enamide (PubChem CID 91259802) has the molecular formula C28H36N2O6S and a molecular weight of 528.67 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-9-phenyl-2,3-dihydro-1,5-benzothiazepin-3-yl)non-6-enamide.
| Compound Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-9-phenyl-2,3-dihydro-1,5-benzothiazepin-3-yl)non-6-enamide |
|---|---|
| PubChem CID | 91259802 |
| Molecular Formula | C28H36N2O6S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(5-methyl-4-oxo-9-phenyl-2,3-dihydro-1,5-benzothiazepin-3-yl)non-6-enamide |
| SMILES | CO[C@@H](C(=O)NC1CSc2c(-c3ccccc3)cccc2N(C)C1=O)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C28H36N2O6S/c1-28(2,3)15-14-21(31)22(32)23(33)24(36-5)26(34)29-19-16-37-25-18(17-10-7-6-8-11-17)12-9-13-20(25)30(4)27(19)35/h6-15,19,21-24,31-33H,16H2,1-5H3,(H,29,34)/t19?,21-,22+,23-,24-/m1/s1 |
| InChIKey | BNJSXLCVQCYJEJ-WZNAITLGSA-N |
| XLogP | 2.61 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|