About 4-fluorohex-4-en-3-imine
4-fluorohex-4-en-3-imine (PubChem CID 91259833) has the molecular formula C6H10FN
and a molecular weight of 115.15 g/mol. Its IUPAC name is 4-fluorohex-4-en-3-imine.
Molecular Properties
| Compound Name | 4-fluorohex-4-en-3-imine |
| PubChem CID | 91259833 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | 4-fluorohex-4-en-3-imine |
| SMILES | [H]/N=C(\CC)C(F)=CC |
| InChI | InChI=1S/C6H10FN/c1-3-5(7)6(8)4-2/h3,8H,4H2,1-2H3/b5-3?,8-6+ |
| InChIKey | OEJGUSNSKUDOLO-NIXDYCKDSA-N |
| XLogP | 2.29 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorohex-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorohex-4-en-3-imine?
The IUPAC name of 4-fluorohex-4-en-3-imine (CID 91259833) is 4-fluorohex-4-en-3-imine.
What is the SMILES notation for 4-fluorohex-4-en-3-imine?
The canonical SMILES for 4-fluorohex-4-en-3-imine is [H]/N=C(\CC)C(F)=CC.
What is the InChIKey of 4-fluorohex-4-en-3-imine?
The InChIKey is OEJGUSNSKUDOLO-NIXDYCKDSA-N. The full InChI is InChI=1S/C6H10FN/c1-3-5(7)6(8)4-2/h3,8H,4H2,1-2H3/b5-3?,8-6+.
What are the key properties of 4-fluorohex-4-en-3-imine?
4-fluorohex-4-en-3-imine has a molecular weight of 115.15 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorohex-4-en-3-imine is sourced from PubChem (CID 91259833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).