C24H27N5O3 — CID 91260923
1-[[1-(4,7-dimethyl-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea;ethane (PubChem CID 91260923) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-[[1-(4,7-dimethyl-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea;ethane.
| Compound Name | 1-[[1-(4,7-dimethyl-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea;ethane |
|---|---|
| PubChem CID | 91260923 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[[1-(4,7-dimethyl-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea;ethane |
| SMILES | CC.Cc1cc2[nH]c(=O)c(=O)n(C)c2cc1-n1ccc(CNC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H21N5O3.C2H6/c1-14-10-17-19(26(2)21(29)20(28)25-17)11-18(14)27-9-8-15(13-27)12-23-22(30)24-16-6-4-3-5-7-16;1-2/h3-11,13H,12H2,1-2H3,(H,25,28)(H2,23,24,30);1-2H3 |
| InChIKey | GEDDEHVZJFYJLD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|