C21H21F2N3O2 — CID 91261317
8-fluoro-3-[[2-(5-fluoro-1H-indol-3-yl)ethylamino]methyl]-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 91261317) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is 8-fluoro-3-[[2-(5-fluoro-1H-indol-3-yl)ethylamino]methyl]-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | 8-fluoro-3-[[2-(5-fluoro-1H-indol-3-yl)ethylamino]methyl]-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 91261317 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 8-fluoro-3-[[2-(5-fluoro-1H-indol-3-yl)ethylamino]methyl]-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | NC(=O)c1ccc(F)c2c1CC(CNCCc1c[nH]c3ccc(F)cc13)CO2 |
| InChI | InChI=1S/C21H21F2N3O2/c22-14-1-4-19-16(8-14)13(10-26-19)5-6-25-9-12-7-17-15(21(24)27)2-3-18(23)20(17)28-11-12/h1-4,8,10,12,25-26H,5-7,9,11H2,(H2,24,27) |
| InChIKey | NLJWUFZNARMNDP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|