About 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene
2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene (PubChem CID 91261352) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene.
Analyze 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene?
The IUPAC name of 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene (CID 91261352) is 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene.
What is the SMILES notation for 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene?
The canonical SMILES for 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene is CCCCC1=C(C)C2=C(CCCC2)C1C.
What is the InChIKey of 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene?
The InChIKey is FOOSWXKKHZZZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24/c1-4-5-8-13-11(2)14-9-6-7-10-15(14)12(13)3/h11H,4-10H2,1-3H3.
What are the key properties of 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene?
2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene has a molecular weight of 204.36 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1,3-dimethyl-4,5,6,7-tetrahydro-1H-indene is sourced from PubChem (CID 91261352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).