About 5-methoxy-4H-1,2,4-benzothiadiazin-3-one
5-methoxy-4H-1,2,4-benzothiadiazin-3-one (PubChem CID 91261539) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 5-methoxy-4H-1,2,4-benzothiadiazin-3-one.
Molecular Properties
| Compound Name | 5-methoxy-4H-1,2,4-benzothiadiazin-3-one |
| PubChem CID | 91261539 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 5-methoxy-4H-1,2,4-benzothiadiazin-3-one |
| SMILES | COc1cccc2c1NC(=O)NS2 |
| InChI | InChI=1S/C8H8N2O2S/c1-12-5-3-2-4-6-7(5)9-8(11)10-13-6/h2-4H,1H3,(H2,9,10,11) |
| InChIKey | MEOFRAGUNKLNPG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-4H-1,2,4-benzothiadiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4H-1,2,4-benzothiadiazin-3-one?
The IUPAC name of 5-methoxy-4H-1,2,4-benzothiadiazin-3-one (CID 91261539) is 5-methoxy-4H-1,2,4-benzothiadiazin-3-one.
What is the SMILES notation for 5-methoxy-4H-1,2,4-benzothiadiazin-3-one?
The canonical SMILES for 5-methoxy-4H-1,2,4-benzothiadiazin-3-one is COc1cccc2c1NC(=O)NS2.
What is the InChIKey of 5-methoxy-4H-1,2,4-benzothiadiazin-3-one?
The InChIKey is MEOFRAGUNKLNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-12-5-3-2-4-6-7(5)9-8(11)10-13-6/h2-4H,1H3,(H2,9,10,11).
What are the key properties of 5-methoxy-4H-1,2,4-benzothiadiazin-3-one?
5-methoxy-4H-1,2,4-benzothiadiazin-3-one has a molecular weight of 196.23 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4H-1,2,4-benzothiadiazin-3-one is sourced from PubChem (CID 91261539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).