C16H32O5SSi — CID 91261741
(7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 91261741) has the molecular formula C16H32O5SSi and a molecular weight of 364.58 g/mol. Its IUPAC name is (7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 91261741 |
| Molecular Formula | C16H32O5SSi |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CSC1OC(CO[Si](C)(C)C(C)(C)C)C2OC(C)(C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C16H32O5SSi/c1-15(2,3)23(7,8)18-9-10-12-13(21-16(4,5)20-12)11(17)14(19-10)22-6/h10-14,17H,9H2,1-8H3/t10?,11-,12?,13+,14?/m0/s1 |
| InChIKey | DXCDWIJNDYLIGO-KSODFNGISA-N |
| XLogP | 2.98 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|