About ethane;thiazepane 1,1-dioxide
ethane;thiazepane 1,1-dioxide (PubChem CID 91261809) has the molecular formula C7H17NO2S
and a molecular weight of 179.28 g/mol. Its IUPAC name is ethane;thiazepane 1,1-dioxide.
Molecular Properties
| Compound Name | ethane;thiazepane 1,1-dioxide |
| PubChem CID | 91261809 |
| Molecular Formula | C7H17NO2S |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 179.10 |
| IUPAC Name | ethane;thiazepane 1,1-dioxide |
| SMILES | CC.O=S1(=O)CCCCCN1 |
| InChI | InChI=1S/C5H11NO2S.C2H6/c7-9(8)5-3-1-2-4-6-9;1-2/h6H,1-5H2;1-2H3 |
| InChIKey | JGDVZIYRWNTWQO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;thiazepane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;thiazepane 1,1-dioxide?
The IUPAC name of ethane;thiazepane 1,1-dioxide (CID 91261809) is ethane;thiazepane 1,1-dioxide.
What is the SMILES notation for ethane;thiazepane 1,1-dioxide?
The canonical SMILES for ethane;thiazepane 1,1-dioxide is CC.O=S1(=O)CCCCCN1.
What is the InChIKey of ethane;thiazepane 1,1-dioxide?
The InChIKey is JGDVZIYRWNTWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2S.C2H6/c7-9(8)5-3-1-2-4-6-9;1-2/h6H,1-5H2;1-2H3.
What are the key properties of ethane;thiazepane 1,1-dioxide?
ethane;thiazepane 1,1-dioxide has a molecular weight of 179.28 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;thiazepane 1,1-dioxide is sourced from PubChem (CID 91261809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).