About [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea
[(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea (PubChem CID 91262164) has the molecular formula C8H10ClN3OS2
and a molecular weight of 263.78 g/mol. Its IUPAC name is [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea.
Molecular Properties
| Compound Name | [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea |
| PubChem CID | 91262164 |
| Molecular Formula | C8H10ClN3OS2 |
| Molecular Weight | 263.78 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea |
| SMILES | CS(=O)(=Cc1ccc(Cl)nc1)NC(N)=S |
| InChI | InChI=1S/C8H10ClN3OS2/c1-15(13,12-8(10)14)5-6-2-3-7(9)11-4-6/h2-5H,1H3,(H3,10,12,13,14) |
| InChIKey | WZWBHIZOTZTJGH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.78 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea?
The IUPAC name of [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea (CID 91262164) is [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea.
What is the SMILES notation for [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea?
The canonical SMILES for [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea is CS(=O)(=Cc1ccc(Cl)nc1)NC(N)=S.
What is the InChIKey of [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea?
The InChIKey is WZWBHIZOTZTJGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3OS2/c1-15(13,12-8(10)14)5-6-2-3-7(9)11-4-6/h2-5H,1H3,(H3,10,12,13,14).
What are the key properties of [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea?
[(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea has a molecular weight of 263.78 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6-chloro-3-pyridinyl)methylidene-methyl-oxo-λ6-sulfanyl]thiourea is sourced from PubChem (CID 91262164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).