C21H33N3S — CID 91262498
4-(4-phenyltridecan-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 91262498) has the molecular formula C21H33N3S and a molecular weight of 359.58 g/mol. Its IUPAC name is 4-(4-phenyltridecan-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-phenyltridecan-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 91262498 |
| Molecular Formula | C21H33N3S |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 4-(4-phenyltridecan-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCCCCCC(C(CCC)c1ccccc1)n1cn[nH]c1=S |
| InChI | InChI=1S/C21H33N3S/c1-3-5-6-7-8-12-16-20(24-17-22-23-21(24)25)19(13-4-2)18-14-10-9-11-15-18/h9-11,14-15,17,19-20H,3-8,12-13,16H2,1-2H3,(H,23,25) |
| InChIKey | DRZIEKJUCAIOHW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|