C24H19F4NO3S — CID 91262920
2-[bis(4-fluorophenyl)methyl]-1-(3,4-difluorophenyl)sulfonylpiperidin-4-one (PubChem CID 91262920) has the molecular formula C24H19F4NO3S and a molecular weight of 477.48 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]-1-(3,4-difluorophenyl)sulfonylpiperidin-4-one.
| Compound Name | 2-[bis(4-fluorophenyl)methyl]-1-(3,4-difluorophenyl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 91262920 |
| Molecular Formula | C24H19F4NO3S |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]-1-(3,4-difluorophenyl)sulfonylpiperidin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)C(C(c2ccc(F)cc2)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H19F4NO3S/c25-17-5-1-15(2-6-17)24(16-3-7-18(26)8-4-16)23-13-19(30)11-12-29(23)33(31,32)20-9-10-21(27)22(28)14-20/h1-10,14,23-24H,11-13H2 |
| InChIKey | HDSWNXOJOBMBJC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |