C13H11F3O5S — CID 91263143
5-(trifluoromethylsulfonyloxy)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxylic acid (PubChem CID 91263143) has the molecular formula C13H11F3O5S and a molecular weight of 336.29 g/mol. Its IUPAC name is 5-(trifluoromethylsulfonyloxy)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxylic acid.
| Compound Name | 5-(trifluoromethylsulfonyloxy)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 91263143 |
| Molecular Formula | C13H11F3O5S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 5-(trifluoromethylsulfonyloxy)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxylic acid |
| SMILES | O=C(O)C1C2CCc3cc(OS(=O)(=O)C(F)(F)F)ccc3C21 |
| InChI | InChI=1S/C13H11F3O5S/c14-13(15,16)22(19,20)21-7-2-4-8-6(5-7)1-3-9-10(8)11(9)12(17)18/h2,4-5,9-11H,1,3H2,(H,17,18) |
| InChIKey | SYBGMUCDDVDPDA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|