C8H6F8OS — CID 91263192
2,4,4,4-tetrafluoro-1-(2,4,4,4-tetrafluorobut-1-enylsulfinyl)but-1-ene (PubChem CID 91263192) has the molecular formula C8H6F8OS and a molecular weight of 302.19 g/mol. Its IUPAC name is 2,4,4,4-tetrafluoro-1-(2,4,4,4-tetrafluorobut-1-enylsulfinyl)but-1-ene.
| Compound Name | 2,4,4,4-tetrafluoro-1-(2,4,4,4-tetrafluorobut-1-enylsulfinyl)but-1-ene |
|---|---|
| PubChem CID | 91263192 |
| Molecular Formula | C8H6F8OS |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2,4,4,4-tetrafluoro-1-(2,4,4,4-tetrafluorobut-1-enylsulfinyl)but-1-ene |
| SMILES | O=S(C=C(F)CC(F)(F)F)C=C(F)CC(F)(F)F |
| InChI | InChI=1S/C8H6F8OS/c9-5(1-7(11,12)13)3-18(17)4-6(10)2-8(14,15)16/h3-4H,1-2H2 |
| InChIKey | BMGJCUFLIILERV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |