C25H29N3O3 — CID 91264055
[[4-[2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]benzoyl]amino] 3,3-dimethylbutanoate (PubChem CID 91264055) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [[4-[2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]benzoyl]amino] 3,3-dimethylbutanoate.
| Compound Name | [[4-[2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]benzoyl]amino] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 91264055 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [[4-[2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]benzoyl]amino] 3,3-dimethylbutanoate |
| SMILES | CN1CCN=C(C=Cc2ccc(C(=O)NOC(=O)CC(C)(C)C)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H29N3O3/c1-25(2,3)17-23(29)31-27-24(30)19-12-9-18(10-13-19)11-14-21-20-7-5-6-8-22(20)28(4)16-15-26-21/h5-14H,15-17H2,1-4H3,(H,27,30) |
| InChIKey | DEPUVKYPZJTFRC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|