C11H17NO — CID 91264485
2-methyl-1-piperidin-1-ylpenta-3,4-dien-1-one (PubChem CID 91264485) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-methyl-1-piperidin-1-ylpenta-3,4-dien-1-one.
| Compound Name | 2-methyl-1-piperidin-1-ylpenta-3,4-dien-1-one |
|---|---|
| PubChem CID | 91264485 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-methyl-1-piperidin-1-ylpenta-3,4-dien-1-one |
| SMILES | C=C=CC(C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H17NO/c1-3-7-10(2)11(13)12-8-5-4-6-9-12/h7,10H,1,4-6,8-9H2,2H3 |
| InChIKey | KJYQPBAEEJCMCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |