C41H73N4O2+ — CID 91264779
1-[3,3,6,6,7,7,10,10,11,11,14,14-dodecamethyl-13-(3-methylimidazol-3-ium-1-yl)-9-(2-oxopyrrolidin-1-yl)pentadec-1-en-5-yl]azepan-2-one (PubChem CID 91264779) has the molecular formula C41H73N4O2+ and a molecular weight of 654.06 g/mol. Its IUPAC name is 1-[3,3,6,6,7,7,10,10,11,11,14,14-dodecamethyl-13-(3-methylimidazol-3-ium-1-yl)-9-(2-oxopyrrolidin-1-yl)pentadec-1-en-5-yl]azepan-2-one.
| Compound Name | 1-[3,3,6,6,7,7,10,10,11,11,14,14-dodecamethyl-13-(3-methylimidazol-3-ium-1-yl)-9-(2-oxopyrrolidin-1-yl)pentadec-1-en-5-yl]azepan-2-one |
|---|---|
| PubChem CID | 91264779 |
| Molecular Formula | C41H73N4O2+ |
| Molecular Weight | 654.06 g/mol |
| Exact Mass | 653.57 |
| IUPAC Name | 1-[3,3,6,6,7,7,10,10,11,11,14,14-dodecamethyl-13-(3-methylimidazol-3-ium-1-yl)-9-(2-oxopyrrolidin-1-yl)pentadec-1-en-5-yl]azepan-2-one |
| SMILES | C=CC(C)(C)CC(N1CCCCCC1=O)C(C)(C)C(C)(C)CC(N1CCCC1=O)C(C)(C)C(C)(C)CC(n1cc[n+](C)c1)C(C)(C)C |
| InChI | InChI=1S/C41H73N4O2/c1-16-37(5,6)27-32(44-23-19-17-18-21-34(44)46)40(11,12)39(9,10)29-33(45-24-20-22-35(45)47)41(13,14)38(7,8)28-31(36(2,3)4)43-26-25-42(15)30-43/h16,25-26,30-33H,1,17-24,27-29H2,2-15H3/q+1 |
| InChIKey | XVSCGONNMARQAZ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 49.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.06 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|