C20H18FN5O4 — CID 91265013
1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(4-fluoro-2-pyridinyl)urea (PubChem CID 91265013) has the molecular formula C20H18FN5O4 and a molecular weight of 411.39 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(4-fluoro-2-pyridinyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(4-fluoro-2-pyridinyl)urea |
|---|---|
| PubChem CID | 91265013 |
| Molecular Formula | C20H18FN5O4 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-(4-fluoro-2-pyridinyl)urea |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)Nc4cc(F)ccn4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C20H18FN5O4/c21-13-5-6-22-16(8-13)24-20(30)23-9-11-1-2-14-12(7-11)10-26(19(14)29)15-3-4-17(27)25-18(15)28/h1-2,5-8,10,15,29H,3-4,9H2,(H,25,27,28)(H2,22,23,24,30) |
| InChIKey | QRJCAHGFSVHKBN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|