C8H9F2N — CID 91265103
3,5-difluoro-4-methylidenecyclohexane-1-carbonitrile (PubChem CID 91265103) has the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. Its IUPAC name is 3,5-difluoro-4-methylidenecyclohexane-1-carbonitrile.
| Compound Name | 3,5-difluoro-4-methylidenecyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 91265103 |
| Molecular Formula | C8H9F2N |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3,5-difluoro-4-methylidenecyclohexane-1-carbonitrile |
| SMILES | C=C1C(F)CC(C#N)CC1F |
| InChI | InChI=1S/C8H9F2N/c1-5-7(9)2-6(4-11)3-8(5)10/h6-8H,1-3H2 |
| InChIKey | XBPGCFIONOIDLT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|