C21H16N2O3S2 — CID 91265517
2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoic acid (PubChem CID 91265517) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoic acid.
| Compound Name | 2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 91265517 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoic acid |
| SMILES | CC(Sc1nc2scc(-c3ccccc3)c2c(=O)n1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H16N2O3S2/c1-13(20(25)26)28-21-22-18-17(16(12-27-18)14-8-4-2-5-9-14)19(24)23(21)15-10-6-3-7-11-15/h2-13H,1H3,(H,25,26) |
| InChIKey | LDZOXAPATJDMCR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |