About 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone
1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (PubChem CID 91265659) has the molecular formula C17H15N4O2P
and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| PubChem CID | 91265659 |
| Molecular Formula | C17H15N4O2P |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c2ncccc12.O=Cc1cn(P)c2ncccc12 |
| InChI | InChI=1S/C9H8N2O.C8H7N2OP/c1-6(12)8-5-11-9-7(8)3-2-4-10-9;11-5-6-4-10(12)8-7(6)2-1-3-9-8/h2-5H,1H3,(H,10,11);1-5H,12H2 |
| InChIKey | LEMQLZNBAQWWKT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone?
The IUPAC name of 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CID 91265659) is 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone.
What is the SMILES notation for 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone?
The canonical SMILES for 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone is CC(=O)c1c[nH]c2ncccc12.O=Cc1cn(P)c2ncccc12.
What is the InChIKey of 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone?
The InChIKey is LEMQLZNBAQWWKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.C8H7N2OP/c1-6(12)8-5-11-9-7(8)3-2-4-10-9;11-5-6-4-10(12)8-7(6)2-1-3-9-8/h2-5H,1H3,(H,10,11);1-5H,12H2.
What are the key properties of 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone?
1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone has a molecular weight of 338.31 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phosphanylpyrrolo[2,3-b]pyridine-3-carbaldehyde;1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone is sourced from PubChem (CID 91265659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).