C75H116O9 — CID 91266361
2,3-bis(2-icosa-5,8,11,14,17-pentaenoxybutanoyloxy)propyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate (PubChem CID 91266361) has the molecular formula C75H116O9 and a molecular weight of 1161.74 g/mol. Its IUPAC name is 2,3-bis(2-icosa-5,8,11,14,17-pentaenoxybutanoyloxy)propyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate.
| Compound Name | 2,3-bis(2-icosa-5,8,11,14,17-pentaenoxybutanoyloxy)propyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate |
|---|---|
| PubChem CID | 91266361 |
| Molecular Formula | C75H116O9 |
| Molecular Weight | 1161.74 g/mol |
| Exact Mass | 1160.86 |
| IUPAC Name | 2,3-bis(2-icosa-5,8,11,14,17-pentaenoxybutanoyloxy)propyl 2-icosa-5,8,11,14,17-pentaenoxybutanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(CC)C(=O)OCC(COC(=O)C(CC)OCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)C(CC)OCCCCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C75H116O9/c1-7-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55-58-61-64-79-70(10-4)73(76)82-67-69(84-75(78)72(12-6)81-66-63-60-57-54-51-48-45-42-39-36-33-30-27-24-21-18-15-9-3)68-83-74(77)71(11-5)80-65-62-59-56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-8-2/h13-18,22-27,31-36,40-45,49-54,69-72H,7-12,19-21,28-30,37-39,46-48,55-68H2,1-6H3 |
| InChIKey | IVOMGZYVCYZNOP-UHFFFAOYSA-N |
| XLogP | 20.14 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1161.74 |
| LogP ≤ 5 | 20.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|