C21H38FN7O2 — CID 91266449
6-fluoro-2-N,4-N-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 91266449) has the molecular formula C21H38FN7O2 and a molecular weight of 439.58 g/mol. Its IUPAC name is 6-fluoro-2-N,4-N-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-fluoro-2-N,4-N-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91266449 |
| Molecular Formula | C21H38FN7O2 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | 6-fluoro-2-N,4-N-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(F)nc(NC3CC(C)(C)N(O)C(C)(C)C3)n2)CC(C)(C)N1O |
| InChI | InChI=1S/C21H38FN7O2/c1-18(2)9-13(10-19(3,4)28(18)30)23-16-25-15(22)26-17(27-16)24-14-11-20(5,6)29(31)21(7,8)12-14/h13-14,30-31H,9-12H2,1-8H3,(H2,23,24,25,26,27) |
| InChIKey | XAQSZDVUUBPLEP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |