C19H21F3N6 — CID 91266578
6-N-(4-aminocyclohexyl)-8-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 91266578) has the molecular formula C19H21F3N6 and a molecular weight of 390.41 g/mol. Its IUPAC name is 6-N-(4-aminocyclohexyl)-8-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 6-N-(4-aminocyclohexyl)-8-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 91266578 |
| Molecular Formula | C19H21F3N6 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 6-N-(4-aminocyclohexyl)-8-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | NC1CCC(Nc2cc(Nc3ccc(C(F)(F)F)cc3)c3nccn3n2)CC1 |
| InChI | InChI=1S/C19H21F3N6/c20-19(21,22)12-1-5-14(6-2-12)25-16-11-17(27-28-10-9-24-18(16)28)26-15-7-3-13(23)4-8-15/h1-2,5-6,9-11,13,15,25H,3-4,7-8,23H2,(H,26,27) |
| InChIKey | IFZLYHHMWASNDF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|