About N-heptan-3-yl-1,3,4-thiadiazol-2-amine
N-heptan-3-yl-1,3,4-thiadiazol-2-amine (PubChem CID 91266698) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is N-heptan-3-yl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-heptan-3-yl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 91266698 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | N-heptan-3-yl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCC(CC)Nc1nncs1 |
| InChI | InChI=1S/C9H17N3S/c1-3-5-6-8(4-2)11-9-12-10-7-13-9/h7-8H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | RTXBGKRWFJRJPT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-heptan-3-yl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-3-yl-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-heptan-3-yl-1,3,4-thiadiazol-2-amine (CID 91266698) is N-heptan-3-yl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-heptan-3-yl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-heptan-3-yl-1,3,4-thiadiazol-2-amine is CCCCC(CC)Nc1nncs1.
What is the InChIKey of N-heptan-3-yl-1,3,4-thiadiazol-2-amine?
The InChIKey is RTXBGKRWFJRJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-3-5-6-8(4-2)11-9-12-10-7-13-9/h7-8H,3-6H2,1-2H3,(H,11,12).
What are the key properties of N-heptan-3-yl-1,3,4-thiadiazol-2-amine?
N-heptan-3-yl-1,3,4-thiadiazol-2-amine has a molecular weight of 199.32 g/mol, XLogP of 2.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-3-yl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 91266698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).