C19H13F3N2O3 — CID 91266761
7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 91266761) has the molecular formula C19H13F3N2O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 91266761 |
| Molecular Formula | C19H13F3N2O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(-n3c(O)c4c(c3O)[C@H]3C=C[C@@H]4C3)cc2[nH]1 |
| InChI | InChI=1S/C19H13F3N2O3/c20-19(21,22)12-7-14(25)23-13-6-10(3-4-11(12)13)24-17(26)15-8-1-2-9(5-8)16(15)18(24)27/h1-4,6-9,26-27H,5H2,(H,23,25)/t8-,9+ |
| InChIKey | TXZGPBAOKLTFSF-DTORHVGOSA-N |
| XLogP | 3.89 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|