C26H26ClNO4 — CID 91267003
4-[5-(6-chloroquinolin-2-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 91267003) has the molecular formula C26H26ClNO4 and a molecular weight of 451.95 g/mol. Its IUPAC name is 4-[5-(6-chloroquinolin-2-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[5-(6-chloroquinolin-2-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 91267003 |
| Molecular Formula | C26H26ClNO4 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-[5-(6-chloroquinolin-2-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(Oc2ccc3cc(Cl)ccc3n2)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C26H26ClNO4/c1-6-15-7-10-18(31-21-12-8-16-13-17(27)9-11-20(16)28-21)14-19(15)22-23(29)25(2,3)32-26(4,5)24(22)30/h7-14,22H,6H2,1-5H3 |
| InChIKey | HERBKIOAVDUTPO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|