About 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole
3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole (PubChem CID 91267391) has the molecular formula C14H12Br2S
and a molecular weight of 372.13 g/mol. Its IUPAC name is 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole.
Molecular Properties
| Compound Name | 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole |
| PubChem CID | 91267391 |
| Molecular Formula | C14H12Br2S |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 369.90 |
| IUPAC Name | 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole |
| SMILES | CC1=C2C(Br)=CC=CC23CC=C(Br)C(C)=C3S1 |
| InChI | InChI=1S/C14H12Br2S/c1-8-10(15)5-7-14-6-3-4-11(16)12(14)9(2)17-13(8)14/h3-6H,7H2,1-2H3 |
| InChIKey | FBTAPINXABNDQZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole?
The IUPAC name of 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole (CID 91267391) is 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole.
What is the SMILES notation for 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole?
The canonical SMILES for 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole is CC1=C2C(Br)=CC=CC23CC=C(Br)C(C)=C3S1.
What is the InChIKey of 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole?
The InChIKey is FBTAPINXABNDQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Br2S/c1-8-10(15)5-7-14-6-3-4-11(16)12(14)9(2)17-13(8)14/h3-6H,7H2,1-2H3.
What are the key properties of 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole?
3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole has a molecular weight of 372.13 g/mol, XLogP of 5.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dibromo-4,6-dimethyl-1H-benzo[c][1]benzothiole is sourced from PubChem (CID 91267391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).