C33H48F3N7O2Si — CID 91267643
4-[2-[4-[1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)-2,6-dihydropurin-8-yl]pyrazol-1-yl]ethyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 91267643) has the molecular formula C33H48F3N7O2Si and a molecular weight of 659.87 g/mol. Its IUPAC name is 4-[2-[4-[1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)-2,6-dihydropurin-8-yl]pyrazol-1-yl]ethyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-[2-[4-[1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)-2,6-dihydropurin-8-yl]pyrazol-1-yl]ethyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91267643 |
| Molecular Formula | C33H48F3N7O2Si |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.36 |
| IUPAC Name | 4-[2-[4-[1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)-2,6-dihydropurin-8-yl]pyrazol-1-yl]ethyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CCCN1Cc2c(nc(-c3cnn(CCC4CC(=O)N(c5cccc(C(F)(F)F)c5)C4)c3)n2COCC[Si](C)(C)C)N(CCC)C1 |
| InChI | InChI=1S/C33H48F3N7O2Si/c1-6-12-39-22-29-32(40(23-39)13-7-2)38-31(43(29)24-45-15-16-46(3,4)5)26-19-37-41(21-26)14-11-25-17-30(44)42(20-25)28-10-8-9-27(18-28)33(34,35)36/h8-10,18-19,21,25H,6-7,11-17,20,22-24H2,1-5H3 |
| InChIKey | MGNGWRFRAOOMPM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 71.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|