C20H30N2O3 — CID 91267999
1-[4-[dihydroxy(5,6,7,8-tetrahydronaphthalen-1-yl)methyl]piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 91267999) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[4-[dihydroxy(5,6,7,8-tetrahydronaphthalen-1-yl)methyl]piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[dihydroxy(5,6,7,8-tetrahydronaphthalen-1-yl)methyl]piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 91267999 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[4-[dihydroxy(5,6,7,8-tetrahydronaphthalen-1-yl)methyl]piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCN(C(O)(O)c2cccc3c2CCCC3)CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-15(2)14-19(23)21-10-12-22(13-11-21)20(24,25)18-9-5-7-16-6-3-4-8-17(16)18/h5,7,9,15,24-25H,3-4,6,8,10-14H2,1-2H3 |
| InChIKey | RRCBQLCEJDMAIK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|