About 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol
3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol (PubChem CID 91268419) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol |
| PubChem CID | 91268419 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol |
| SMILES | Cc1cccc(-c2cc(O)[nH]c2O)c1C |
| InChI | InChI=1S/C12H13NO2/c1-7-4-3-5-9(8(7)2)10-6-11(14)13-12(10)15/h3-6,13-15H,1-2H3 |
| InChIKey | ZENLSEGJKFHZJE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol?
The IUPAC name of 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol (CID 91268419) is 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol.
What is the SMILES notation for 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol?
The canonical SMILES for 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol is Cc1cccc(-c2cc(O)[nH]c2O)c1C.
What is the InChIKey of 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol?
The InChIKey is ZENLSEGJKFHZJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-7-4-3-5-9(8(7)2)10-6-11(14)13-12(10)15/h3-6,13-15H,1-2H3.
What are the key properties of 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol?
3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol has a molecular weight of 203.24 g/mol, XLogP of 2.71, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylphenyl)-1H-pyrrole-2,5-diol is sourced from PubChem (CID 91268419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).