C26H32F3N3O2 — CID 91268669
(1S,2R,3R,4R)-3-N-(4-pyrrolidin-1-ylbutyl)-2-[(2,3,5-trifluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 91268669) has the molecular formula C26H32F3N3O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-N-(4-pyrrolidin-1-ylbutyl)-2-[(2,3,5-trifluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-3-N-(4-pyrrolidin-1-ylbutyl)-2-[(2,3,5-trifluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 91268669 |
| Molecular Formula | C26H32F3N3O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (1S,2R,3R,4R)-3-N-(4-pyrrolidin-1-ylbutyl)-2-[(2,3,5-trifluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | NC(=O)[C@@]1(Cc2cc(F)cc(F)c2F)[C@H](C(=O)NCCCCN2CCCC2)[C@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C26H32F3N3O2/c27-17-13-16(22(29)19(28)14-17)15-26(24(30)34)20-6-5-18(25(20)7-8-25)21(26)23(33)31-9-1-2-10-32-11-3-4-12-32/h5-6,13-14,18,20-21H,1-4,7-12,15H2,(H2,30,34)(H,31,33)/t18-,20+,21+,26-/m1/s1 |
| InChIKey | MBCROSCPWJZPAS-DROMZSTPSA-N |
| XLogP | 3.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|