About 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one
6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one (PubChem CID 91268679) has the molecular formula C8H4Cl2N2O2
and a molecular weight of 231.04 g/mol. Its IUPAC name is 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one |
| PubChem CID | 91268679 |
| Molecular Formula | C8H4Cl2N2O2 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one |
| SMILES | O=NC1C(=O)Nc2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C8H4Cl2N2O2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12-14/h1-2,7H,(H,11,13) |
| InChIKey | BRCXDQBDNVIIAO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one?
The IUPAC name of 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one (CID 91268679) is 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one.
What is the SMILES notation for 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one?
The canonical SMILES for 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one is O=NC1C(=O)Nc2c1ccc(Cl)c2Cl.
What is the InChIKey of 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one?
The InChIKey is BRCXDQBDNVIIAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2O2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12-14/h1-2,7H,(H,11,13).
What are the key properties of 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one?
6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one has a molecular weight of 231.04 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-3-nitroso-1,3-dihydroindol-2-one is sourced from PubChem (CID 91268679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).