C16H24O6 — CID 91269110
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R)-2-(4-methylphenyl)propoxy]oxane-3,4,5-triol (PubChem CID 91269110) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R)-2-(4-methylphenyl)propoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R)-2-(4-methylphenyl)propoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91269110 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R)-2-(4-methylphenyl)propoxy]oxane-3,4,5-triol |
| SMILES | Cc1ccc([C@@H](C)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C16H24O6/c1-9-3-5-11(6-4-9)10(2)8-21-16-15(20)14(19)13(18)12(7-17)22-16/h3-6,10,12-20H,7-8H2,1-2H3/t10-,12+,13+,14-,15+,16+/m0/s1 |
| InChIKey | BDIXMGXQXAYDPF-JOSVURMMSA-N |
| XLogP | -0.08 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |