C15H18N2 — CID 91269235
(4-methylphenyl)-[(3E,5Z)-octa-3,5,7-trien-4-yl]diazene (PubChem CID 91269235) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (4-methylphenyl)-[(3E,5Z)-octa-3,5,7-trien-4-yl]diazene.
| Compound Name | (4-methylphenyl)-[(3E,5Z)-octa-3,5,7-trien-4-yl]diazene |
|---|---|
| PubChem CID | 91269235 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (4-methylphenyl)-[(3E,5Z)-octa-3,5,7-trien-4-yl]diazene |
| SMILES | C=C/C=C\C(=C/CC)\N=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C15H18N2/c1-4-6-8-14(7-5-2)16-17-15-11-9-13(3)10-12-15/h4,6-12H,1,5H2,2-3H3/b8-6-,14-7+,17-16+ |
| InChIKey | DQZUEUTVKFKDAJ-OVTIYDSCSA-N |
| XLogP | 5.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|