C10H11F4N2O2+ — CID 91269274
[1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium-2-yl] 2-methylprop-2-enoate (PubChem CID 91269274) has the molecular formula C10H11F4N2O2+ and a molecular weight of 267.20 g/mol. Its IUPAC name is [1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91269274 |
| Molecular Formula | C10H11F4N2O2+ |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | [1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1n(C(F)(F)C(F)F)cc[n+]1C |
| InChI | InChI=1S/C10H11F4N2O2/c1-6(2)7(17)18-9-15(3)4-5-16(9)10(13,14)8(11)12/h4-5,8H,1H2,2-3H3/q+1 |
| InChIKey | HUWOIOQXHVPKGD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|