About N-benzyl-2,6-dimethylbenzenecarboximidate
N-benzyl-2,6-dimethylbenzenecarboximidate (PubChem CID 91269599) has the molecular formula C16H16NO-
and a molecular weight of 238.31 g/mol. Its IUPAC name is N-benzyl-2,6-dimethylbenzenecarboximidate.
Molecular Properties
| Compound Name | N-benzyl-2,6-dimethylbenzenecarboximidate |
| PubChem CID | 91269599 |
| Molecular Formula | C16H16NO- |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-benzyl-2,6-dimethylbenzenecarboximidate |
| SMILES | Cc1cccc(C)c1/C([O-])=N/Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-12-7-6-8-13(2)15(12)16(18)17-11-14-9-4-3-5-10-14/h3-10H,11H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | WAUUKMDAEQLARF-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2,6-dimethylbenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,6-dimethylbenzenecarboximidate?
The IUPAC name of N-benzyl-2,6-dimethylbenzenecarboximidate (CID 91269599) is N-benzyl-2,6-dimethylbenzenecarboximidate.
What is the SMILES notation for N-benzyl-2,6-dimethylbenzenecarboximidate?
The canonical SMILES for N-benzyl-2,6-dimethylbenzenecarboximidate is Cc1cccc(C)c1/C([O-])=N/Cc1ccccc1.
What is the InChIKey of N-benzyl-2,6-dimethylbenzenecarboximidate?
The InChIKey is WAUUKMDAEQLARF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H17NO/c1-12-7-6-8-13(2)15(12)16(18)17-11-14-9-4-3-5-10-14/h3-10H,11H2,1-2H3,(H,17,18)/p-1.
What are the key properties of N-benzyl-2,6-dimethylbenzenecarboximidate?
N-benzyl-2,6-dimethylbenzenecarboximidate has a molecular weight of 238.31 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,6-dimethylbenzenecarboximidate is sourced from PubChem (CID 91269599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).