C22H31F2NO5S — CID 91269915
7-[(1R,5S)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid (PubChem CID 91269915) has the molecular formula C22H31F2NO5S and a molecular weight of 459.56 g/mol. Its IUPAC name is 7-[(1R,5S)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,5S)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 91269915 |
| Molecular Formula | C22H31F2NO5S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 7-[(1R,5S)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoic acid |
| SMILES | O=NC1C[C@H](O)[C@H](CCCCCCC(=O)O)C1CC[C@@H](O)CSc1ccc(F)cc1F |
| InChI | InChI=1S/C22H31F2NO5S/c23-14-7-10-21(18(24)11-14)31-13-15(26)8-9-16-17(20(27)12-19(16)25-30)5-3-1-2-4-6-22(28)29/h7,10-11,15-17,19-20,26-27H,1-6,8-9,12-13H2,(H,28,29)/t15-,16?,17-,19?,20+/m1/s1 |
| InChIKey | XWHIMRVVTMBOLO-PGROUEESSA-N |
| XLogP | 4.76 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|