C68H124O14 — CID 91270099
12-butyl-10,11,11,12-tetrakis(9-carboxynonyl)henicosane-1,10,21-tricarboxylic acid (PubChem CID 91270099) has the molecular formula C68H124O14 and a molecular weight of 1165.73 g/mol. Its IUPAC name is 12-butyl-10,11,11,12-tetrakis(9-carboxynonyl)henicosane-1,10,21-tricarboxylic acid.
| Compound Name | 12-butyl-10,11,11,12-tetrakis(9-carboxynonyl)henicosane-1,10,21-tricarboxylic acid |
|---|---|
| PubChem CID | 91270099 |
| Molecular Formula | C68H124O14 |
| Molecular Weight | 1165.73 g/mol |
| Exact Mass | 1164.90 |
| IUPAC Name | 12-butyl-10,11,11,12-tetrakis(9-carboxynonyl)henicosane-1,10,21-tricarboxylic acid |
| SMILES | CCCCC(CCCCCCCCCC(=O)O)(CCCCCCCCCC(=O)O)C(CCCCCCCCCC(=O)O)(CCCCCCCCCC(=O)O)C(CCCCCCCCCC(=O)O)(CCCCCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C68H124O14/c1-2-3-52-66(53-40-28-16-4-10-22-34-46-59(69)70,54-41-29-17-5-11-23-35-47-60(71)72)68(57-44-32-20-8-14-26-38-50-63(77)78,58-45-33-21-9-15-27-39-51-64(79)80)67(65(81)82,55-42-30-18-6-12-24-36-48-61(73)74)56-43-31-19-7-13-25-37-49-62(75)76/h2-58H2,1H3,(H,69,70)(H,71,72)(H,73,74)(H,75,76)(H,77,78)(H,79,80)(H,81,82) |
| InChIKey | VVQIBEVLLJOXGY-UHFFFAOYSA-N |
| XLogP | 19.79 |
| TPSA | 261.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1165.73 |
| LogP ≤ 5 | 19.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|