C26H38F3N5O5 — CID 91270130
N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamoylamino]butanamide (PubChem CID 91270130) has the molecular formula C26H38F3N5O5 and a molecular weight of 557.61 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamoylamino]butanamide.
| Compound Name | N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamoylamino]butanamide |
|---|---|
| PubChem CID | 91270130 |
| Molecular Formula | C26H38F3N5O5 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamoylamino]butanamide |
| SMILES | CC(C)(C)C(NC(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1)C(=O)N(CC(=O)NO)CC1CCCC1 |
| InChI | InChI=1S/C26H38F3N5O5/c1-25(2,3)22(23(36)34(16-21(35)32-38)15-17-6-4-5-7-17)31-24(37)30-19-14-18(26(27,28)29)8-9-20(19)33-10-12-39-13-11-33/h8-9,14,17,22,38H,4-7,10-13,15-16H2,1-3H3,(H,32,35)(H2,30,31,37) |
| InChIKey | WCXPDMNRIPSWLC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|