C17H24F3N3O2 — CID 91270478
1-[3-(4-prop-2-ynylpiperazin-1-yl)propyl]-3-(3,3,3-trifluoropropyl)pyrrole-2,5-diol (PubChem CID 91270478) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-[3-(4-prop-2-ynylpiperazin-1-yl)propyl]-3-(3,3,3-trifluoropropyl)pyrrole-2,5-diol.
| Compound Name | 1-[3-(4-prop-2-ynylpiperazin-1-yl)propyl]-3-(3,3,3-trifluoropropyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91270478 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[3-(4-prop-2-ynylpiperazin-1-yl)propyl]-3-(3,3,3-trifluoropropyl)pyrrole-2,5-diol |
| SMILES | C#CCN1CCN(CCCn2c(O)cc(CCC(F)(F)F)c2O)CC1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-2-6-21-9-11-22(12-10-21)7-3-8-23-15(24)13-14(16(23)25)4-5-17(18,19)20/h1,13,24-25H,3-12H2 |
| InChIKey | RYEPPPHHHXJMFA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|