C11H21N5O — CID 91270663
3,3,5,5-tetramethyl-6-(2H-tetrazol-5-yl)hexanamide (PubChem CID 91270663) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-6-(2H-tetrazol-5-yl)hexanamide.
| Compound Name | 3,3,5,5-tetramethyl-6-(2H-tetrazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 91270663 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3,3,5,5-tetramethyl-6-(2H-tetrazol-5-yl)hexanamide |
| SMILES | CC(C)(CC(N)=O)CC(C)(C)Cc1nn[nH]n1 |
| InChI | InChI=1S/C11H21N5O/c1-10(2,5-8(12)17)7-11(3,4)6-9-13-15-16-14-9/h5-7H2,1-4H3,(H2,12,17)(H,13,14,15,16) |
| InChIKey | SZZFBZAYBYQAND-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |