C22H24N7O+ — CID 91270787
6-[[1-methyl-6-(4,5,6,7-tetrahydro-1H-indazol-6-yl)-5,6-dihydroimidazo[1,2-a]pyrazin-1-ium-8-yl]amino]-1,3-dihydroindol-2-one (PubChem CID 91270787) has the molecular formula C22H24N7O+ and a molecular weight of 402.48 g/mol. Its IUPAC name is 6-[[1-methyl-6-(4,5,6,7-tetrahydro-1H-indazol-6-yl)-5,6-dihydroimidazo[1,2-a]pyrazin-1-ium-8-yl]amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-[[1-methyl-6-(4,5,6,7-tetrahydro-1H-indazol-6-yl)-5,6-dihydroimidazo[1,2-a]pyrazin-1-ium-8-yl]amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91270787 |
| Molecular Formula | C22H24N7O+ |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 6-[[1-methyl-6-(4,5,6,7-tetrahydro-1H-indazol-6-yl)-5,6-dihydroimidazo[1,2-a]pyrazin-1-ium-8-yl]amino]-1,3-dihydroindol-2-one |
| SMILES | C[n+]1ccn2c1C(Nc1ccc3c(c1)NC(=O)C3)=NC(C1CCc3cn[nH]c3C1)C2 |
| InChI | InChI=1S/C22H23N7O/c1-28-6-7-29-12-19(13-2-3-15-11-23-27-18(15)8-13)26-21(22(28)29)24-16-5-4-14-9-20(30)25-17(14)10-16/h4-7,10-11,13,19H,2-3,8-9,12H2,1H3,(H2-,23,24,25,26,27,30)/p+1 |
| InChIKey | GWGVLVZGIXQMGW-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|