C44H26F10N6+2 — CID 91271367
5,10-bis(1-methylpyridin-1-ium-4-yl)-15,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91271367) has the molecular formula C44H26F10N6+2 and a molecular weight of 828.71 g/mol. Its IUPAC name is 5,10-bis(1-methylpyridin-1-ium-4-yl)-15,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10-bis(1-methylpyridin-1-ium-4-yl)-15,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91271367 |
| Molecular Formula | C44H26F10N6+2 |
| Molecular Weight | 828.71 g/mol |
| Exact Mass | 828.20 |
| IUPAC Name | 5,10-bis(1-methylpyridin-1-ium-4-yl)-15,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | C[n+]1ccc(C2=c3ccc([nH]3)=C(c3cc[n+](C)cc3)c3ccc([nH]3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C44H24F10N6/c1-59-15-11-19(12-16-59)29-21-3-4-22(55-21)30(20-13-17-60(2)18-14-20)24-6-8-26(57-24)32(34-37(47)41(51)44(54)42(52)38(34)48)28-10-9-27(58-28)31(25-7-5-23(29)56-25)33-35(45)39(49)43(53)40(50)36(33)46/h3-18,55H,1-2H3,(H,56,57,58)/p+2 |
| InChIKey | FEFVBLMMARCOIG-UHFFFAOYSA-P |
| XLogP | 5.34 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|