About 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide
4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide (PubChem CID 91271432) has the molecular formula C17H17N5O2
and a molecular weight of 323.36 g/mol. Its IUPAC name is 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide |
| PubChem CID | 91271432 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide |
| SMILES | Cc1ncc(-c2nc(-c3ccc(C(=O)N(C)C)cc3)cnc2N)o1 |
| InChI | InChI=1S/C17H17N5O2/c1-10-19-9-14(24-10)15-16(18)20-8-13(21-15)11-4-6-12(7-5-11)17(23)22(2)3/h4-9H,1-3H3,(H2,18,20) |
| InChIKey | DQSDBDNGIWCZBZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide?
The IUPAC name of 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide (CID 91271432) is 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide?
The canonical SMILES for 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide is Cc1ncc(-c2nc(-c3ccc(C(=O)N(C)C)cc3)cnc2N)o1.
What is the InChIKey of 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide?
The InChIKey is DQSDBDNGIWCZBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O2/c1-10-19-9-14(24-10)15-16(18)20-8-13(21-15)11-4-6-12(7-5-11)17(23)22(2)3/h4-9H,1-3H3,(H2,18,20).
What are the key properties of 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide?
4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide has a molecular weight of 323.36 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-amino-6-(2-methyl-1,3-oxazol-5-yl)pyrazin-2-yl]-N,N-dimethylbenzamide is sourced from PubChem (CID 91271432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).