C20H29N3O5 — CID 91271644
N-[1-cyclohexyl-3-[(2,5-dihydroxypyrrol-1-yl)amino]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide (PubChem CID 91271644) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[1-cyclohexyl-3-[(2,5-dihydroxypyrrol-1-yl)amino]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide.
| Compound Name | N-[1-cyclohexyl-3-[(2,5-dihydroxypyrrol-1-yl)amino]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 91271644 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[1-cyclohexyl-3-[(2,5-dihydroxypyrrol-1-yl)amino]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)C=CC(=O)NC(C(=O)C(=O)Nn1c(O)ccc1O)C1CCCCC1 |
| InChI | InChI=1S/C20H29N3O5/c1-20(2,3)12-11-14(24)21-17(13-7-5-4-6-8-13)18(27)19(28)22-23-15(25)9-10-16(23)26/h9-13,17,25-26H,4-8H2,1-3H3,(H,21,24)(H,22,28) |
| InChIKey | OUNMKXBROMKENS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|