C11H9BrFNO2 — CID 91271720
1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2,5-diol (PubChem CID 91271720) has the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2,5-diol.
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91271720 |
| Molecular Formula | C11H9BrFNO2 |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H9BrFNO2/c12-8-5-7(1-2-9(8)13)6-14-10(15)3-4-11(14)16/h1-5,15-16H,6H2 |
| InChIKey | UPVJDGVFCGQZMM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |