C13H18N2 — CID 91271745
5,6-diazatricyclo[9.4.0.02,7]pentadeca-5,11,13-triene (PubChem CID 91271745) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5,6-diazatricyclo[9.4.0.02,7]pentadeca-5,11,13-triene.
| Compound Name | 5,6-diazatricyclo[9.4.0.02,7]pentadeca-5,11,13-triene |
|---|---|
| PubChem CID | 91271745 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 5,6-diazatricyclo[9.4.0.02,7]pentadeca-5,11,13-triene |
| SMILES | C1=CCC2C(=C1)CCCC1N=NCCC12 |
| InChI | InChI=1S/C13H18N2/c1-2-6-11-10(4-1)5-3-7-13-12(11)8-9-14-15-13/h1-2,4,11-13H,3,5-9H2 |
| InChIKey | OIEHKGHSNAVSNP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |