About N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide
N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide (PubChem CID 91271821) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide |
| PubChem CID | 91271821 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide |
| SMILES | C=CCC(=O)/N=c1\sccn1C |
| InChI | InChI=1S/C8H10N2OS/c1-3-4-7(11)9-8-10(2)5-6-12-8/h3,5-6H,1,4H2,2H3/b9-8- |
| InChIKey | DJMQWPGBIBBHEC-HJWRWDBZSA-N |
| XLogP | 1.09 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide?
The IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide (CID 91271821) is N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide.
What is the SMILES notation for N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide?
The canonical SMILES for N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide is C=CCC(=O)/N=c1\sccn1C.
What is the InChIKey of N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide?
The InChIKey is DJMQWPGBIBBHEC-HJWRWDBZSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-3-4-7(11)9-8-10(2)5-6-12-8/h3,5-6H,1,4H2,2H3/b9-8-.
What are the key properties of N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide?
N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide has a molecular weight of 182.25 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,3-thiazol-2-ylidene)but-3-enamide is sourced from PubChem (CID 91271821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).